C14H17N3O5P+ — CID 174841106
[[carboxy(phenyl)methyl]amino]-(4-ethyl-2,3-dioxopiperazin-1-yl)-oxophosphanium (PubChem CID 174841106) has the molecular formula C14H17N3O5P+ and a molecular weight of 338.28 g/mol. Its IUPAC name is [[carboxy(phenyl)methyl]amino]-(4-ethyl-2,3-dioxopiperazin-1-yl)-oxophosphanium.
| Compound Name | [[carboxy(phenyl)methyl]amino]-(4-ethyl-2,3-dioxopiperazin-1-yl)-oxophosphanium |
|---|---|
| PubChem CID | 174841106 |
| Molecular Formula | C14H17N3O5P+ |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [[carboxy(phenyl)methyl]amino]-(4-ethyl-2,3-dioxopiperazin-1-yl)-oxophosphanium |
| SMILES | CCN1CCN([P+](=O)NC(C(=O)O)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C14H16N3O5P/c1-2-16-8-9-17(13(19)12(16)18)23(22)15-11(14(20)21)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H-,15,20,21,22)/p+1 |
| InChIKey | UVKSYEQQSMPOAN-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|