About 3-(1-fluoroethyl)-2H-1,3-benzoxazole
3-(1-fluoroethyl)-2H-1,3-benzoxazole (PubChem CID 174841645) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-2H-1,3-benzoxazole.
Molecular Properties
| Compound Name | 3-(1-fluoroethyl)-2H-1,3-benzoxazole |
| PubChem CID | 174841645 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-(1-fluoroethyl)-2H-1,3-benzoxazole |
| SMILES | CC(F)N1COc2ccccc21 |
| InChI | InChI=1S/C9H10FNO/c1-7(10)11-6-12-9-5-3-2-4-8(9)11/h2-5,7H,6H2,1H3 |
| InChIKey | VHZSVHVWUBFRNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-fluoroethyl)-2H-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-fluoroethyl)-2H-1,3-benzoxazole?
The IUPAC name of 3-(1-fluoroethyl)-2H-1,3-benzoxazole (CID 174841645) is 3-(1-fluoroethyl)-2H-1,3-benzoxazole.
What is the SMILES notation for 3-(1-fluoroethyl)-2H-1,3-benzoxazole?
The canonical SMILES for 3-(1-fluoroethyl)-2H-1,3-benzoxazole is CC(F)N1COc2ccccc21.
What is the InChIKey of 3-(1-fluoroethyl)-2H-1,3-benzoxazole?
The InChIKey is VHZSVHVWUBFRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO/c1-7(10)11-6-12-9-5-3-2-4-8(9)11/h2-5,7H,6H2,1H3.
What are the key properties of 3-(1-fluoroethyl)-2H-1,3-benzoxazole?
3-(1-fluoroethyl)-2H-1,3-benzoxazole has a molecular weight of 167.18 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-fluoroethyl)-2H-1,3-benzoxazole is sourced from PubChem (CID 174841645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).