C9H10FNO — CID 174841645
3-(1-fluoroethyl)-2H-1,3-benzoxazole (PubChem CID 174841645) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 3-(1-fluoroethyl)-2H-1,3-benzoxazole.
| Compound Name | 3-(1-fluoroethyl)-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 174841645 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-(1-fluoroethyl)-2H-1,3-benzoxazole |
| SMILES | CC(F)N1COc2ccccc21 |
| InChI | InChI=1S/C9H10FNO/c1-7(10)11-6-12-9-5-3-2-4-8(9)11/h2-5,7H,6H2,1H3 |
| InChIKey | VHZSVHVWUBFRNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|