About isoquinoline;5H-pyrrolo[2,3-b]pyrazine
isoquinoline;5H-pyrrolo[2,3-b]pyrazine (PubChem CID 174842867) has the molecular formula C15H12N4
and a molecular weight of 248.29 g/mol. Its IUPAC name is isoquinoline;5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | isoquinoline;5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 174842867 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | isoquinoline;5H-pyrrolo[2,3-b]pyrazine |
| SMILES | c1ccc2cnccc2c1.c1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C9H7N.C6H5N3/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-8-6-5(1)7-3-4-9-6/h1-7H;1-4H,(H,8,9) |
| InChIKey | HWMLGXKOWRNIMR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze isoquinoline;5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline;5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of isoquinoline;5H-pyrrolo[2,3-b]pyrazine (CID 174842867) is isoquinoline;5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for isoquinoline;5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for isoquinoline;5H-pyrrolo[2,3-b]pyrazine is c1ccc2cnccc2c1.c1cnc2[nH]ccc2n1.
What is the InChIKey of isoquinoline;5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is HWMLGXKOWRNIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H5N3/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-8-6-5(1)7-3-4-9-6/h1-7H;1-4H,(H,8,9).
What are the key properties of isoquinoline;5H-pyrrolo[2,3-b]pyrazine?
isoquinoline;5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 248.29 g/mol, XLogP of 3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline;5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 174842867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).