C22H19N3 — CID 174873057
(4S)-4-pyrimidin-2-yl-3,4,5,6-tetrahydrochrysen-2-amine (PubChem CID 174873057) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is (4S)-4-pyrimidin-2-yl-3,4,5,6-tetrahydrochrysen-2-amine.
| Compound Name | (4S)-4-pyrimidin-2-yl-3,4,5,6-tetrahydrochrysen-2-amine |
|---|---|
| PubChem CID | 174873057 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (4S)-4-pyrimidin-2-yl-3,4,5,6-tetrahydrochrysen-2-amine |
| SMILES | NC1=Cc2ccc3c(c2[C@@H](c2ncccn2)C1)CCc1ccccc1-3 |
| InChI | InChI=1S/C22H19N3/c23-16-12-15-7-8-18-17-5-2-1-4-14(17)6-9-19(18)21(15)20(13-16)22-24-10-3-11-25-22/h1-5,7-8,10-12,20H,6,9,13,23H2/t20-/m0/s1 |
| InChIKey | CIYYWINMDCCKAI-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |