C8H6F2N2O3 — CID 174886798
(2,6-difluorophenyl) 2-hydrazinyl-2-oxoacetate (PubChem CID 174886798) has the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. Its IUPAC name is (2,6-difluorophenyl) 2-hydrazinyl-2-oxoacetate.
| Compound Name | (2,6-difluorophenyl) 2-hydrazinyl-2-oxoacetate |
|---|---|
| PubChem CID | 174886798 |
| Molecular Formula | C8H6F2N2O3 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (2,6-difluorophenyl) 2-hydrazinyl-2-oxoacetate |
| SMILES | NNC(=O)C(=O)Oc1c(F)cccc1F |
| InChI | InChI=1S/C8H6F2N2O3/c9-4-2-1-3-5(10)6(4)15-8(14)7(13)12-11/h1-3H,11H2,(H,12,13) |
| InChIKey | NQSRLENESYSMAM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|