C12H23NO4Si — CID 174895651
1-(4,4-diethoxy-1-silylbutyl)pyrrolidine-2,5-dione (PubChem CID 174895651) has the molecular formula C12H23NO4Si and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-(4,4-diethoxy-1-silylbutyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4,4-diethoxy-1-silylbutyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174895651 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(4,4-diethoxy-1-silylbutyl)pyrrolidine-2,5-dione |
| SMILES | CCOC(CCC([SiH3])N1C(=O)CCC1=O)OCC |
| InChI | InChI=1S/C12H23NO4Si/c1-3-16-12(17-4-2)8-7-11(18)13-9(14)5-6-10(13)15/h11-12H,3-8H2,1-2,18H3 |
| InChIKey | LAYQBIVENQZKLX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|