C80H98N8O4 — CID 174943279
bis(2,12-dioctyl-21,22-dihydroporphyrin);phthalic acid (PubChem CID 174943279) has the molecular formula C80H98N8O4 and a molecular weight of 1235.72 g/mol. Its IUPAC name is bis(2,12-dioctyl-21,22-dihydroporphyrin);phthalic acid.
| Compound Name | bis(2,12-dioctyl-21,22-dihydroporphyrin);phthalic acid |
|---|---|
| PubChem CID | 174943279 |
| Molecular Formula | C80H98N8O4 |
| Molecular Weight | 1235.72 g/mol |
| Exact Mass | 1234.77 |
| IUPAC Name | bis(2,12-dioctyl-21,22-dihydroporphyrin);phthalic acid |
| SMILES | CCCCCCCCC1=Cc2cc3nc(cc4[nH]c(cc4CCCCCCCC)cc4ccc(cc1n2)[nH]4)C=C3.CCCCCCCCC1=Cc2cc3nc(cc4[nH]c(cc4CCCCCCCC)cc4ccc(cc1n2)[nH]4)C=C3.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/2C36H46N4.C8H6O4/c2*1-3-5-7-9-11-13-15-27-21-33-23-29-18-20-32(38-29)26-36-28(16-14-12-10-8-6-4-2)22-34(40-36)24-30-17-19-31(37-30)25-35(27)39-33;9-7(10)5-3-1-2-4-6(5)8(11)12/h2*17-26,37,40H,3-16H2,1-2H3;1-4H,(H,9,10)(H,11,12)/b2*29-23-,30-24-,31-25-,32-26-,33-23-,34-24-,35-25-,36-26-; |
| InChIKey | OGPOSPHWIQQMQY-OYNLZAOOSA-N |
| XLogP | 22.44 |
| TPSA | 189.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1235.72 |
| LogP ≤ 5 | 22.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|