C8H2Cl3N5O2 — CID 174952354
1-(2,4,6-trichloro-3,5-dinitrosophenyl)-1,2,4-triazole (PubChem CID 174952354) has the molecular formula C8H2Cl3N5O2 and a molecular weight of 306.50 g/mol. Its IUPAC name is 1-(2,4,6-trichloro-3,5-dinitrosophenyl)-1,2,4-triazole.
| Compound Name | 1-(2,4,6-trichloro-3,5-dinitrosophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 174952354 |
| Molecular Formula | C8H2Cl3N5O2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | 1-(2,4,6-trichloro-3,5-dinitrosophenyl)-1,2,4-triazole |
| SMILES | O=Nc1c(Cl)c(N=O)c(Cl)c(-n2cncn2)c1Cl |
| InChI | InChI=1S/C8H2Cl3N5O2/c9-3-6(14-17)4(10)8(5(11)7(3)15-18)16-2-12-1-13-16/h1-2H |
| InChIKey | LJBYYROQHZUYDA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |