C21H25N3O5 — CID 175006629
1,8-dimethoxy-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylic acid (PubChem CID 175006629) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1,8-dimethoxy-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylic acid.
| Compound Name | 1,8-dimethoxy-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 175006629 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1,8-dimethoxy-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylic acid |
| SMILES | COc1cc2c3c(OC)nccc3n(C(=O)O)c2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C21H25N3O5/c1-27-17-12-14-16(13-18(17)29-11-5-10-23-8-3-4-9-23)24(21(25)26)15-6-7-22-20(28-2)19(14)15/h6-7,12-13H,3-5,8-11H2,1-2H3,(H,25,26) |
| InChIKey | JDPRICABEOLJHU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|