C29H39N3O6 — CID 137356596
tert-butyl 8-methoxy-1-(oxan-4-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylate (PubChem CID 137356596) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is tert-butyl 8-methoxy-1-(oxan-4-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylate.
| Compound Name | tert-butyl 8-methoxy-1-(oxan-4-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 137356596 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | tert-butyl 8-methoxy-1-(oxan-4-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)pyrido[4,3-b]indole-5-carboxylate |
| SMILES | COc1cc2c3c(OC4CCOCC4)nccc3n(C(=O)OC(C)(C)C)c2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C29H39N3O6/c1-29(2,3)38-28(33)32-22-8-11-30-27(37-20-9-16-35-17-10-20)26(22)21-18-24(34-4)25(19-23(21)32)36-15-7-14-31-12-5-6-13-31/h8,11,18-20H,5-7,9-10,12-17H2,1-4H3 |
| InChIKey | GQCVOEXWMIPSIN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 84.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|