About 2-phenoxy-1H-pyrrole-3,4-diamine
2-phenoxy-1H-pyrrole-3,4-diamine (PubChem CID 175019974) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-phenoxy-1H-pyrrole-3,4-diamine.
Molecular Properties
| Compound Name | 2-phenoxy-1H-pyrrole-3,4-diamine |
| PubChem CID | 175019974 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-phenoxy-1H-pyrrole-3,4-diamine |
| SMILES | Nc1c[nH]c(Oc2ccccc2)c1N |
| InChI | InChI=1S/C10H11N3O/c11-8-6-13-10(9(8)12)14-7-4-2-1-3-5-7/h1-6,13H,11-12H2 |
| InChIKey | RDZAYKQZNVAZSV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxy-1H-pyrrole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxy-1H-pyrrole-3,4-diamine?
The IUPAC name of 2-phenoxy-1H-pyrrole-3,4-diamine (CID 175019974) is 2-phenoxy-1H-pyrrole-3,4-diamine.
What is the SMILES notation for 2-phenoxy-1H-pyrrole-3,4-diamine?
The canonical SMILES for 2-phenoxy-1H-pyrrole-3,4-diamine is Nc1c[nH]c(Oc2ccccc2)c1N.
What is the InChIKey of 2-phenoxy-1H-pyrrole-3,4-diamine?
The InChIKey is RDZAYKQZNVAZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c11-8-6-13-10(9(8)12)14-7-4-2-1-3-5-7/h1-6,13H,11-12H2.
What are the key properties of 2-phenoxy-1H-pyrrole-3,4-diamine?
2-phenoxy-1H-pyrrole-3,4-diamine has a molecular weight of 189.22 g/mol, XLogP of 1.97, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-1H-pyrrole-3,4-diamine is sourced from PubChem (CID 175019974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).