C16H9Cl2F3O5S — CID 175046024
[5-[2-(3,5-dichlorophenyl)ethenyl]-2-(trifluoromethylsulfonyloxy)phenyl] formate (PubChem CID 175046024) has the molecular formula C16H9Cl2F3O5S and a molecular weight of 441.21 g/mol. Its IUPAC name is [5-[2-(3,5-dichlorophenyl)ethenyl]-2-(trifluoromethylsulfonyloxy)phenyl] formate.
| Compound Name | [5-[2-(3,5-dichlorophenyl)ethenyl]-2-(trifluoromethylsulfonyloxy)phenyl] formate |
|---|---|
| PubChem CID | 175046024 |
| Molecular Formula | C16H9Cl2F3O5S |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | [5-[2-(3,5-dichlorophenyl)ethenyl]-2-(trifluoromethylsulfonyloxy)phenyl] formate |
| SMILES | O=COc1cc(C=Cc2cc(Cl)cc(Cl)c2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H9Cl2F3O5S/c17-12-5-11(6-13(18)8-12)2-1-10-3-4-14(15(7-10)25-9-22)26-27(23,24)16(19,20)21/h1-9H |
| InChIKey | LIWGANWSCGMLSC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|