About sodium;hydride;(4-sulfamoylanilino) acetate
sodium;hydride;(4-sulfamoylanilino) acetate (PubChem CID 175057030) has the molecular formula C8H11N2NaO4S
and a molecular weight of 254.24 g/mol. Its IUPAC name is sodium;hydride;(4-sulfamoylanilino) acetate.
Molecular Properties
| Compound Name | sodium;hydride;(4-sulfamoylanilino) acetate |
| PubChem CID | 175057030 |
| Molecular Formula | C8H11N2NaO4S |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | sodium;hydride;(4-sulfamoylanilino) acetate |
| SMILES | CC(=O)ONc1ccc(S(N)(=O)=O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C8H10N2O4S.Na.H/c1-6(11)14-10-7-2-4-8(5-3-7)15(9,12)13;;/h2-5,10H,1H3,(H2,9,12,13);;/q;+1;-1 |
| InChIKey | NLLMHDJFXMLKSY-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(4-sulfamoylanilino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(4-sulfamoylanilino) acetate?
The IUPAC name of sodium;hydride;(4-sulfamoylanilino) acetate (CID 175057030) is sodium;hydride;(4-sulfamoylanilino) acetate.
What is the SMILES notation for sodium;hydride;(4-sulfamoylanilino) acetate?
The canonical SMILES for sodium;hydride;(4-sulfamoylanilino) acetate is CC(=O)ONc1ccc(S(N)(=O)=O)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;(4-sulfamoylanilino) acetate?
The InChIKey is NLLMHDJFXMLKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4S.Na.H/c1-6(11)14-10-7-2-4-8(5-3-7)15(9,12)13;;/h2-5,10H,1H3,(H2,9,12,13);;/q;+1;-1.
What are the key properties of sodium;hydride;(4-sulfamoylanilino) acetate?
sodium;hydride;(4-sulfamoylanilino) acetate has a molecular weight of 254.24 g/mol, XLogP of -2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(4-sulfamoylanilino) acetate is sourced from PubChem (CID 175057030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).