C17H14BNO3 — CID 175060853
(4,6-diphenyl-2-pyridinyl)oxyboronic acid (PubChem CID 175060853) has the molecular formula C17H14BNO3 and a molecular weight of 291.12 g/mol. Its IUPAC name is (4,6-diphenyl-2-pyridinyl)oxyboronic acid.
| Compound Name | (4,6-diphenyl-2-pyridinyl)oxyboronic acid |
|---|---|
| PubChem CID | 175060853 |
| Molecular Formula | C17H14BNO3 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (4,6-diphenyl-2-pyridinyl)oxyboronic acid |
| SMILES | OB(O)Oc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H14BNO3/c20-18(21)22-17-12-15(13-7-3-1-4-8-13)11-16(19-17)14-9-5-2-6-10-14/h1-12,20-21H |
| InChIKey | SSSRHSFARVYYTQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|