C15H17ClN5O5P — CID 175071005
chlorophosphonic acid;9-[2-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-ylmethoxy)propan-2-yl]purin-6-amine (PubChem CID 175071005) has the molecular formula C15H17ClN5O5P and a molecular weight of 413.76 g/mol. Its IUPAC name is chlorophosphonic acid;9-[2-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-ylmethoxy)propan-2-yl]purin-6-amine.
| Compound Name | chlorophosphonic acid;9-[2-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-ylmethoxy)propan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 175071005 |
| Molecular Formula | C15H17ClN5O5P |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | chlorophosphonic acid;9-[2-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-ylmethoxy)propan-2-yl]purin-6-amine |
| SMILES | CC(C)(OCc1cccc2c1O2)n1cnc2c(N)ncnc21.O=P(O)(O)Cl |
| InChI | InChI=1S/C15H15N5O2.ClH2O3P/c1-15(2,21-6-9-4-3-5-10-12(9)22-10)20-8-19-11-13(16)17-7-18-14(11)20;1-5(2,3)4/h3-5,7-8H,6H2,1-2H3,(H2,16,17,18);(H2,2,3,4) |
| InChIKey | JIXDRFPHEVWIGB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|