C27H63Al3 — CID 175084040
2,3-dimethylheptylalumane (PubChem CID 175084040) has the molecular formula C27H63Al3 and a molecular weight of 468.75 g/mol. Its IUPAC name is 2,3-dimethylheptylalumane.
| Compound Name | 2,3-dimethylheptylalumane |
|---|---|
| PubChem CID | 175084040 |
| Molecular Formula | C27H63Al3 |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.44 |
| IUPAC Name | 2,3-dimethylheptylalumane |
| SMILES | CCCCC(C)C(C)C[AlH2].CCCCC(C)C(C)C[AlH2].CCCCC(C)C(C)C[AlH2] |
| InChI | InChI=1S/3C9H19.3Al.6H/c3*1-5-6-7-9(4)8(2)3;;;;;;;;;/h3*8-9H,2,5-7H2,1,3-4H3;;;;;;;;; |
| InChIKey | SFDDKMBZFMGIHI-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |