C30H18O8S — CID 175098018
bis(2-methyl-9,10-dioxoanthracen-1-yl) sulfate (PubChem CID 175098018) has the molecular formula C30H18O8S and a molecular weight of 538.53 g/mol. Its IUPAC name is bis(2-methyl-9,10-dioxoanthracen-1-yl) sulfate.
| Compound Name | bis(2-methyl-9,10-dioxoanthracen-1-yl) sulfate |
|---|---|
| PubChem CID | 175098018 |
| Molecular Formula | C30H18O8S |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | bis(2-methyl-9,10-dioxoanthracen-1-yl) sulfate |
| SMILES | Cc1ccc2c(c1OS(=O)(=O)Oc1c(C)ccc3c1C(=O)c1ccccc1C3=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H18O8S/c1-15-11-13-21-23(27(33)19-9-5-3-7-17(19)25(21)31)29(15)37-39(35,36)38-30-16(2)12-14-22-24(30)28(34)20-10-6-4-8-18(20)26(22)32/h3-14H,1-2H3 |
| InChIKey | HYJNULUEDLQIAJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|