5-(cyanoamino)pentanoic acid

C6H10N2O2 — CID 175100097

IUPAC5-(cyanoamino)pentanoic acid
SMILESN#CNCCCCC(=O)O
InChIInChI=1S/C6H10N2O2/c7-5-8-4-2-1-3-6(9)10/h8H,1-4H2,(H,9,10)
InChIKeyJTTKTXJBMZITJO-UHFFFAOYSA-N
MW142.16 g/mol
LogP0.31
Rot. Bonds5

About 5-(cyanoamino)pentanoic acid

5-(cyanoamino)pentanoic acid (PubChem CID 175100097) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 5-(cyanoamino)pentanoic acid.

Molecular Properties

Compound Name5-(cyanoamino)pentanoic acid
PubChem CID175100097
Molecular FormulaC6H10N2O2
Molecular Weight142.16 g/mol
Exact Mass142.07
IUPAC Name5-(cyanoamino)pentanoic acid
SMILESN#CNCCCCC(=O)O
InChIInChI=1S/C6H10N2O2/c7-5-8-4-2-1-3-6(9)10/h8H,1-4H2,(H,9,10)
InChIKeyJTTKTXJBMZITJO-UHFFFAOYSA-N
XLogP0.31
TPSA73.12 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.16
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}

Analyze 5-(cyanoamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(cyanoamino)pentanoic acid?
The IUPAC name of 5-(cyanoamino)pentanoic acid (CID 175100097) is 5-(cyanoamino)pentanoic acid.
What is the SMILES notation for 5-(cyanoamino)pentanoic acid?
The canonical SMILES for 5-(cyanoamino)pentanoic acid is N#CNCCCCC(=O)O.
What is the InChIKey of 5-(cyanoamino)pentanoic acid?
The InChIKey is JTTKTXJBMZITJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c7-5-8-4-2-1-3-6(9)10/h8H,1-4H2,(H,9,10).
What are the key properties of 5-(cyanoamino)pentanoic acid?
5-(cyanoamino)pentanoic acid has a molecular weight of 142.16 g/mol, XLogP of 0.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyanoamino)pentanoic acid is sourced from PubChem (CID 175100097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).