About 5-(cyanoamino)pentanoic acid
5-(cyanoamino)pentanoic acid (PubChem CID 175100097) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 5-(cyanoamino)pentanoic acid.
Molecular Properties
| Compound Name | 5-(cyanoamino)pentanoic acid |
| PubChem CID | 175100097 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 5-(cyanoamino)pentanoic acid |
| SMILES | N#CNCCCCC(=O)O |
| InChI | InChI=1S/C6H10N2O2/c7-5-8-4-2-1-3-6(9)10/h8H,1-4H2,(H,9,10) |
| InChIKey | JTTKTXJBMZITJO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyanoamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyanoamino)pentanoic acid?
The IUPAC name of 5-(cyanoamino)pentanoic acid (CID 175100097) is 5-(cyanoamino)pentanoic acid.
What is the SMILES notation for 5-(cyanoamino)pentanoic acid?
The canonical SMILES for 5-(cyanoamino)pentanoic acid is N#CNCCCCC(=O)O.
What is the InChIKey of 5-(cyanoamino)pentanoic acid?
The InChIKey is JTTKTXJBMZITJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c7-5-8-4-2-1-3-6(9)10/h8H,1-4H2,(H,9,10).
What are the key properties of 5-(cyanoamino)pentanoic acid?
5-(cyanoamino)pentanoic acid has a molecular weight of 142.16 g/mol, XLogP of 0.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyanoamino)pentanoic acid is sourced from PubChem (CID 175100097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).