C12H21N5O4P+ — CID 175104237
[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]oxy-dihydroxy-methylphosphanium;molecular hydrogen (PubChem CID 175104237) has the molecular formula C12H21N5O4P+ and a molecular weight of 330.31 g/mol. Its IUPAC name is [(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]oxy-dihydroxy-methylphosphanium;molecular hydrogen.
| Compound Name | [(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]oxy-dihydroxy-methylphosphanium;molecular hydrogen |
|---|---|
| PubChem CID | 175104237 |
| Molecular Formula | C12H21N5O4P+ |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]oxy-dihydroxy-methylphosphanium;molecular hydrogen |
| SMILES | COc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](O[P+](C)(O)O)C1.[H][H].[H][H] |
| InChI | InChI=1S/C12H17N5O4P.2H2/c1-20-11-9-10(15-12(13)16-11)17(6-14-9)7-3-4-8(5-7)21-22(2,18)19;;/h3-4,6-8,18-19H,5H2,1-2H3,(H2,13,15,16);2*1H/q+1;;/t7-,8+;;/m0../s1 |
| InChIKey | YOLHTKIKVDXERB-OXOJUWDDSA-N |
| XLogP | 1.17 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|