C27H31ClF3NO4S — CID 175123735
N-[5-chloro-1-(2-methylpropyl)-4-phenyl-5-(trifluoromethoxy)cyclohex-3-en-1-yl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 175123735) has the molecular formula C27H31ClF3NO4S and a molecular weight of 558.06 g/mol. Its IUPAC name is N-[5-chloro-1-(2-methylpropyl)-4-phenyl-5-(trifluoromethoxy)cyclohex-3-en-1-yl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[5-chloro-1-(2-methylpropyl)-4-phenyl-5-(trifluoromethoxy)cyclohex-3-en-1-yl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 175123735 |
| Molecular Formula | C27H31ClF3NO4S |
| Molecular Weight | 558.06 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[5-chloro-1-(2-methylpropyl)-4-phenyl-5-(trifluoromethoxy)cyclohex-3-en-1-yl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)NC2(CC(C)C)CC=C(c3ccccc3)C(Cl)(OC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C27H31ClF3NO4S/c1-4-37(34,35)22-12-10-20(11-13-22)16-24(33)32-25(17-19(2)3)15-14-23(21-8-6-5-7-9-21)26(28,18-25)36-27(29,30)31/h5-14,19H,4,15-18H2,1-3H3,(H,32,33) |
| InChIKey | FOMKFDMTXBPDSG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.06 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|