C19H14FeO2-6 — CID 175148250
2-(2-cyclopenta-2,4-dien-1-ylethynyl)benzoic acid;cyclopentane;iron (PubChem CID 175148250) has the molecular formula C19H14FeO2-6 and a molecular weight of 330.16 g/mol. Its IUPAC name is 2-(2-cyclopenta-2,4-dien-1-ylethynyl)benzoic acid;cyclopentane;iron.
| Compound Name | 2-(2-cyclopenta-2,4-dien-1-ylethynyl)benzoic acid;cyclopentane;iron |
|---|---|
| PubChem CID | 175148250 |
| Molecular Formula | C19H14FeO2-6 |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(2-cyclopenta-2,4-dien-1-ylethynyl)benzoic acid;cyclopentane;iron |
| SMILES | O=C(O)c1ccccc1C#C[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C14H9O2.C5H5.Fe/c15-14(16)13-8-4-3-7-12(13)10-9-11-5-1-2-6-11;1-2-4-5-3-1;/h1-8H,(H,15,16);1-5H;/q-1;-5; |
| InChIKey | NCLGZJZLRHPSOJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|