C34H24N2O11 — CID 175152109
oxiran-2-ylmethyl 2-[4-[3-[5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxoisoindol-2-yl]phenoxy]phenyl]-1,3,2-benzodioxazole-5-carboxylate (PubChem CID 175152109) has the molecular formula C34H24N2O11 and a molecular weight of 636.57 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-[4-[3-[5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxoisoindol-2-yl]phenoxy]phenyl]-1,3,2-benzodioxazole-5-carboxylate.
| Compound Name | oxiran-2-ylmethyl 2-[4-[3-[5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxoisoindol-2-yl]phenoxy]phenyl]-1,3,2-benzodioxazole-5-carboxylate |
|---|---|
| PubChem CID | 175152109 |
| Molecular Formula | C34H24N2O11 |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | oxiran-2-ylmethyl 2-[4-[3-[5-(oxiran-2-ylmethoxycarbonyl)-1,3-dioxoisoindol-2-yl]phenoxy]phenyl]-1,3,2-benzodioxazole-5-carboxylate |
| SMILES | O=C(OCC1CO1)c1ccc2c(c1)ON(c1ccc(Oc3cccc(N4C(=O)c5ccc(C(=O)OCC6CO6)cc5C4=O)c3)cc1)O2 |
| InChI | InChI=1S/C34H24N2O11/c37-31-27-10-4-19(33(39)43-17-25-15-41-25)12-28(27)32(38)35(31)22-2-1-3-24(14-22)45-23-8-6-21(7-9-23)36-46-29-11-5-20(13-30(29)47-36)34(40)44-18-26-16-42-26/h1-14,25-26H,15-18H2 |
| InChIKey | JOZUPQGPGYZRDV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 145.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|