C18H37NO7Si — CID 175153550
1-(1-but-3-en-2-yloxyethoxy)ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 175153550) has the molecular formula C18H37NO7Si and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-(1-but-3-en-2-yloxyethoxy)ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 1-(1-but-3-en-2-yloxyethoxy)ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 175153550 |
| Molecular Formula | C18H37NO7Si |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-(1-but-3-en-2-yloxyethoxy)ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | C=CC(C)OC(C)OC(C)OC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C18H37NO7Si/c1-8-15(5)24-16(6)25-17(7)26-18(20)19-13-12-14-27(21-9-2,22-10-3)23-11-4/h8,15-17H,1,9-14H2,2-7H3,(H,19,20) |
| InChIKey | AMPIDECJWNFWPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|