About cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium
cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium (PubChem CID 175171362) has the molecular formula C29H34O3P+
and a molecular weight of 461.56 g/mol. Its IUPAC name is cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium.
Molecular Properties
| Compound Name | cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium |
| PubChem CID | 175171362 |
| Molecular Formula | C29H34O3P+ |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium |
| SMILES | CC(C)c1ccccc1.CC(C)c1ccccc1C(=O)[P+](=O)C(=O)c1ccccc1C(C)C |
| InChI | InChI=1S/C20H22O3P.C9H12/c1-13(2)15-9-5-7-11-17(15)19(21)24(23)20(22)18-12-8-6-10-16(18)14(3)4;1-8(2)9-6-4-3-5-7-9/h5-14H,1-4H3;3-8H,1-2H3/q+1; |
| InChIKey | VTUQPVIFIDFEQA-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium?
The IUPAC name of cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium (CID 175171362) is cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium.
What is the SMILES notation for cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium?
The canonical SMILES for cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium is CC(C)c1ccccc1.CC(C)c1ccccc1C(=O)[P+](=O)C(=O)c1ccccc1C(C)C.
What is the InChIKey of cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium?
The InChIKey is VTUQPVIFIDFEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O3P.C9H12/c1-13(2)15-9-5-7-11-17(15)19(21)24(23)20(22)18-12-8-6-10-16(18)14(3)4;1-8(2)9-6-4-3-5-7-9/h5-14H,1-4H3;3-8H,1-2H3/q+1;.
What are the key properties of cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium?
cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium has a molecular weight of 461.56 g/mol, XLogP of 8.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;oxo-bis(2-propan-2-ylbenzoyl)phosphanium is sourced from PubChem (CID 175171362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).