C14H22N4O2 — CID 175245246
5,7-dimethoxy-2-N,2-N',4-N-trimethyl-1H-quinoline-2,2,4-triamine (PubChem CID 175245246) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 5,7-dimethoxy-2-N,2-N',4-N-trimethyl-1H-quinoline-2,2,4-triamine.
| Compound Name | 5,7-dimethoxy-2-N,2-N',4-N-trimethyl-1H-quinoline-2,2,4-triamine |
|---|---|
| PubChem CID | 175245246 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5,7-dimethoxy-2-N,2-N',4-N-trimethyl-1H-quinoline-2,2,4-triamine |
| SMILES | CNC1=CC(NC)(NC)Nc2cc(OC)cc(OC)c21 |
| InChI | InChI=1S/C14H22N4O2/c1-15-11-8-14(16-2,17-3)18-10-6-9(19-4)7-12(20-5)13(10)11/h6-8,15-18H,1-5H3 |
| InChIKey | GJCSVOYIRHRJNB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|