C24H16N4O8S2 — CID 175265123
bis[(5-phenyl-1,3-thiazol-4-yl)oxycarbonylamino] (E)-but-2-enedioate (PubChem CID 175265123) has the molecular formula C24H16N4O8S2 and a molecular weight of 552.55 g/mol. Its IUPAC name is bis[(5-phenyl-1,3-thiazol-4-yl)oxycarbonylamino] (E)-but-2-enedioate.
| Compound Name | bis[(5-phenyl-1,3-thiazol-4-yl)oxycarbonylamino] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 175265123 |
| Molecular Formula | C24H16N4O8S2 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | bis[(5-phenyl-1,3-thiazol-4-yl)oxycarbonylamino] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)ONC(=O)Oc1ncsc1-c1ccccc1)ONC(=O)Oc1ncsc1-c1ccccc1 |
| InChI | InChI=1S/C24H16N4O8S2/c29-17(35-27-23(31)33-21-19(37-13-25-21)15-7-3-1-4-8-15)11-12-18(30)36-28-24(32)34-22-20(38-14-26-22)16-9-5-2-6-10-16/h1-14H,(H,27,31)(H,28,32)/b12-11+ |
| InChIKey | KUXNYYCEQLQPFK-VAWYXSNFSA-N |
| XLogP | 4.28 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|