C10H17BN2O6 — CID 175283098
[4,5,5-tris(hydroxymethyl)-2-(1-methylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methanol (PubChem CID 175283098) has the molecular formula C10H17BN2O6 and a molecular weight of 272.07 g/mol. Its IUPAC name is [4,5,5-tris(hydroxymethyl)-2-(1-methylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methanol.
| Compound Name | [4,5,5-tris(hydroxymethyl)-2-(1-methylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methanol |
|---|---|
| PubChem CID | 175283098 |
| Molecular Formula | C10H17BN2O6 |
| Molecular Weight | 272.07 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [4,5,5-tris(hydroxymethyl)-2-(1-methylpyrazol-4-yl)-1,3,2-dioxaborolan-4-yl]methanol |
| SMILES | Cn1cc(B2OC(CO)(CO)C(CO)(CO)O2)cn1 |
| InChI | InChI=1S/C10H17BN2O6/c1-13-3-8(2-12-13)11-18-9(4-14,5-15)10(6-16,7-17)19-11/h2-3,14-17H,4-7H2,1H3 |
| InChIKey | HYHMWROEZKTQFY-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.07 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|