C23H29NO5 — CID 175286087
4-[(2,4-dimethoxyphenyl)methyl]-6-methyl-2-(phenylmethoxymethyl)morpholine-3-carbaldehyde (PubChem CID 175286087) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-6-methyl-2-(phenylmethoxymethyl)morpholine-3-carbaldehyde.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-6-methyl-2-(phenylmethoxymethyl)morpholine-3-carbaldehyde |
|---|---|
| PubChem CID | 175286087 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-6-methyl-2-(phenylmethoxymethyl)morpholine-3-carbaldehyde |
| SMILES | COc1ccc(CN2CC(C)OC(COCc3ccccc3)C2C=O)c(OC)c1 |
| InChI | InChI=1S/C23H29NO5/c1-17-12-24(13-19-9-10-20(26-2)11-22(19)27-3)21(14-25)23(29-17)16-28-15-18-7-5-4-6-8-18/h4-11,14,17,21,23H,12-13,15-16H2,1-3H3 |
| InChIKey | LUMSAIURGVGGDW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|