C9H11Cl2NO3S — CID 175331044
2-chloro-1-methyl-2,3-dihydroindole-6-sulfonic acid;hydrochloride (PubChem CID 175331044) has the molecular formula C9H11Cl2NO3S and a molecular weight of 284.16 g/mol. Its IUPAC name is 2-chloro-1-methyl-2,3-dihydroindole-6-sulfonic acid;hydrochloride.
| Compound Name | 2-chloro-1-methyl-2,3-dihydroindole-6-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 175331044 |
| Molecular Formula | C9H11Cl2NO3S |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-chloro-1-methyl-2,3-dihydroindole-6-sulfonic acid;hydrochloride |
| SMILES | CN1c2cc(S(=O)(=O)O)ccc2CC1Cl.Cl |
| InChI | InChI=1S/C9H10ClNO3S.ClH/c1-11-8-5-7(15(12,13)14)3-2-6(8)4-9(11)10;/h2-3,5,9H,4H2,1H3,(H,12,13,14);1H |
| InChIKey | DTXVROZQEFUEIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|