C6HAgN4O8 — CID 175355231
silver 2,4,6-trinitropyridine-3-carboxylate (PubChem CID 175355231) has the molecular formula C6HAgN4O8 and a molecular weight of 364.96 g/mol. Its IUPAC name is silver 2,4,6-trinitropyridine-3-carboxylate.
| Compound Name | silver 2,4,6-trinitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 175355231 |
| Molecular Formula | C6HAgN4O8 |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 363.88 |
| IUPAC Name | silver 2,4,6-trinitropyridine-3-carboxylate |
| SMILES | O=C([O-])c1c([N+](=O)[O-])cc([N+](=O)[O-])nc1[N+](=O)[O-].[Ag+] |
| InChI | InChI=1S/C6H2N4O8.Ag/c11-6(12)4-2(8(13)14)1-3(9(15)16)7-5(4)10(17)18;/h1H,(H,11,12);/q;+1/p-1 |
| InChIKey | RGFKDFOQCDVVFL-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 182.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|