About 3,4,5,6-tetramethylthiazepine
3,4,5,6-tetramethylthiazepine (PubChem CID 175359734) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 3,4,5,6-tetramethylthiazepine.
Molecular Properties
| Compound Name | 3,4,5,6-tetramethylthiazepine |
| PubChem CID | 175359734 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 3,4,5,6-tetramethylthiazepine |
| SMILES | CC1=CSN=C(C)C(C)=C1C |
| InChI | InChI=1S/C9H13NS/c1-6-5-11-10-9(4)8(3)7(6)2/h5H,1-4H3 |
| InChIKey | YMJGLZOKLBDZAA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5,6-tetramethylthiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetramethylthiazepine?
The IUPAC name of 3,4,5,6-tetramethylthiazepine (CID 175359734) is 3,4,5,6-tetramethylthiazepine.
What is the SMILES notation for 3,4,5,6-tetramethylthiazepine?
The canonical SMILES for 3,4,5,6-tetramethylthiazepine is CC1=CSN=C(C)C(C)=C1C.
What is the InChIKey of 3,4,5,6-tetramethylthiazepine?
The InChIKey is YMJGLZOKLBDZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-6-5-11-10-9(4)8(3)7(6)2/h5H,1-4H3.
What are the key properties of 3,4,5,6-tetramethylthiazepine?
3,4,5,6-tetramethylthiazepine has a molecular weight of 167.28 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetramethylthiazepine is sourced from PubChem (CID 175359734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).