C9H13NS — CID 150872956
3,4-diethylthiazepine (PubChem CID 150872956) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 3,4-diethylthiazepine.
| Compound Name | 3,4-diethylthiazepine |
|---|---|
| PubChem CID | 150872956 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 3,4-diethylthiazepine |
| SMILES | CCC1=CC=CSN=C1CC |
| InChI | InChI=1S/C9H13NS/c1-3-8-6-5-7-11-10-9(8)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | KUKQGMSBPZZKGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|