C12H3N5O5 — CID 175378391
1,4-diisocyanato-2-(triisocyanatomethyl)benzene (PubChem CID 175378391) has the molecular formula C12H3N5O5 and a molecular weight of 297.19 g/mol. Its IUPAC name is 1,4-diisocyanato-2-(triisocyanatomethyl)benzene.
| Compound Name | 1,4-diisocyanato-2-(triisocyanatomethyl)benzene |
|---|---|
| PubChem CID | 175378391 |
| Molecular Formula | C12H3N5O5 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 1,4-diisocyanato-2-(triisocyanatomethyl)benzene |
| SMILES | O=C=Nc1ccc(N=C=O)c(C(N=C=O)(N=C=O)N=C=O)c1 |
| InChI | InChI=1S/C12H3N5O5/c18-4-13-9-1-2-11(14-5-19)10(3-9)12(15-6-20,16-7-21)17-8-22/h1-3H |
| InChIKey | WGYYIGBZVRKHTA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 147.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|