C9H19NO3 — CID 175381048
3-[3-(prop-2-enylamino)propoxy]propane-1,2-diol (PubChem CID 175381048) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 3-[3-(prop-2-enylamino)propoxy]propane-1,2-diol.
| Compound Name | 3-[3-(prop-2-enylamino)propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 175381048 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 3-[3-(prop-2-enylamino)propoxy]propane-1,2-diol |
| SMILES | C=CCNCCCOCC(O)CO |
| InChI | InChI=1S/C9H19NO3/c1-2-4-10-5-3-6-13-8-9(12)7-11/h2,9-12H,1,3-8H2 |
| InChIKey | IOCYXRGDJCWUPN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|