C26H31ClF2N6O2 — CID 175387422
tert-butyl N-[4-[4-[5-chloro-7-(3,3-dimethylbutan-2-ylamino)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenyl]but-3-ynyl]carbamate (PubChem CID 175387422) has the molecular formula C26H31ClF2N6O2 and a molecular weight of 533.02 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[5-chloro-7-(3,3-dimethylbutan-2-ylamino)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenyl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[5-chloro-7-(3,3-dimethylbutan-2-ylamino)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 175387422 |
| Molecular Formula | C26H31ClF2N6O2 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | tert-butyl N-[4-[4-[5-chloro-7-(3,3-dimethylbutan-2-ylamino)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluorophenyl]but-3-ynyl]carbamate |
| SMILES | CC(Nc1c(-c2c(F)cc(C#CCCNC(=O)OC(C)(C)C)cc2F)c(Cl)nc2ncnn12)C(C)(C)C |
| InChI | InChI=1S/C26H31ClF2N6O2/c1-15(25(2,3)4)33-22-20(21(27)34-23-31-14-32-35(22)23)19-17(28)12-16(13-18(19)29)10-8-9-11-30-24(36)37-26(5,6)7/h12-15,33H,9,11H2,1-7H3,(H,30,36) |
| InChIKey | LHGSNMFMUPKRTN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|