C25H33Cl2N5O6 — CID 178023538
tert-butyl N-[6,7-dichloro-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-b]pyridazin-8-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 178023538) has the molecular formula C25H33Cl2N5O6 and a molecular weight of 570.47 g/mol. Its IUPAC name is tert-butyl N-[6,7-dichloro-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-b]pyridazin-8-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[6,7-dichloro-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-b]pyridazin-8-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 178023538 |
| Molecular Formula | C25H33Cl2N5O6 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | tert-butyl N-[6,7-dichloro-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-b]pyridazin-8-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC#Cc1cnc2c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(Cl)c(Cl)nn12 |
| InChI | InChI=1S/C25H33Cl2N5O6/c1-23(2,3)36-20(33)28-13-11-10-12-15-14-29-19-17(16(26)18(27)30-32(15)19)31(21(34)37-24(4,5)6)22(35)38-25(7,8)9/h14H,11,13H2,1-9H3,(H,28,33) |
| InChIKey | JWZIFLVITGCZIF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|