C26H36N4O6 — CID 178024578
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-a]pyridin-8-yl]carbamate (PubChem CID 178024578) has the molecular formula C26H36N4O6 and a molecular weight of 500.60 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-a]pyridin-8-yl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-a]pyridin-8-yl]carbamate |
|---|---|
| PubChem CID | 178024578 |
| Molecular Formula | C26H36N4O6 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]imidazo[1,2-a]pyridin-8-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC#Cc1cnc2c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cccn12 |
| InChI | InChI=1S/C26H36N4O6/c1-24(2,3)34-21(31)27-15-11-10-13-18-17-28-20-19(14-12-16-29(18)20)30(22(32)35-25(4,5)6)23(33)36-26(7,8)9/h12,14,16-17H,11,15H2,1-9H3,(H,27,31) |
| InChIKey | WXEGHYGUSGTWJZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|