(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid

C8H11BO6 — CID 175394311

IUPAC(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid
SMILESCOc1cc(OC)cc(OB(O)OO)c1
InChIInChI=1S/C8H11BO6/c1-12-6-3-7(13-2)5-8(4-6)14-9(10)15-11/h3-5,10-11H,1-2H3
InChIKeyRVCUHSKYLHUHSL-UHFFFAOYSA-N
MW213.98 g/mol
LogP0.55
Rot. Bonds5

About (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid

(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid (PubChem CID 175394311) has the molecular formula C8H11BO6 and a molecular weight of 213.98 g/mol. Its IUPAC name is (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid.

Molecular Properties

Compound Name(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid
PubChem CID175394311
Molecular FormulaC8H11BO6
Molecular Weight213.98 g/mol
Exact Mass214.06
IUPAC Name(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid
SMILESCOc1cc(OC)cc(OB(O)OO)c1
InChIInChI=1S/C8H11BO6/c1-12-6-3-7(13-2)5-8(4-6)14-9(10)15-11/h3-5,10-11H,1-2H3
InChIKeyRVCUHSKYLHUHSL-UHFFFAOYSA-N
XLogP0.55
TPSA77.38 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.98
LogP ≤ 50.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid?
The IUPAC name of (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid (CID 175394311) is (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid.
What is the SMILES notation for (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid?
The canonical SMILES for (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid is COc1cc(OC)cc(OB(O)OO)c1.
What is the InChIKey of (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid?
The InChIKey is RVCUHSKYLHUHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BO6/c1-12-6-3-7(13-2)5-8(4-6)14-9(10)15-11/h3-5,10-11H,1-2H3.
What are the key properties of (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid?
(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid has a molecular weight of 213.98 g/mol, XLogP of 0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid is sourced from PubChem (CID 175394311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).