C8H11BO6 — CID 175394311
(3,5-dimethoxyphenoxy)-hydroperoxyborinic acid (PubChem CID 175394311) has the molecular formula C8H11BO6 and a molecular weight of 213.98 g/mol. Its IUPAC name is (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid.
| Compound Name | (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid |
|---|---|
| PubChem CID | 175394311 |
| Molecular Formula | C8H11BO6 |
| Molecular Weight | 213.98 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (3,5-dimethoxyphenoxy)-hydroperoxyborinic acid |
| SMILES | COc1cc(OC)cc(OB(O)OO)c1 |
| InChI | InChI=1S/C8H11BO6/c1-12-6-3-7(13-2)5-8(4-6)14-9(10)15-11/h3-5,10-11H,1-2H3 |
| InChIKey | RVCUHSKYLHUHSL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.98 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|