C20H40N2 — CID 175403485
1-(2-tert-butylcyclohexyl)-2-[4-(2-methylpropyl)cyclohexyl]hydrazine (PubChem CID 175403485) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 1-(2-tert-butylcyclohexyl)-2-[4-(2-methylpropyl)cyclohexyl]hydrazine.
| Compound Name | 1-(2-tert-butylcyclohexyl)-2-[4-(2-methylpropyl)cyclohexyl]hydrazine |
|---|---|
| PubChem CID | 175403485 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 1-(2-tert-butylcyclohexyl)-2-[4-(2-methylpropyl)cyclohexyl]hydrazine |
| SMILES | CC(C)CC1CCC(NNC2CCCCC2C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H40N2/c1-15(2)14-16-10-12-17(13-11-16)21-22-19-9-7-6-8-18(19)20(3,4)5/h15-19,21-22H,6-14H2,1-5H3 |
| InChIKey | CQWOZHPIBATNFX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|