C24H20O5P+ — CID 175409528
cyclohexa-2,5-diene-1,4-dione;hydroxy-diphenoxy-phenylphosphanium (PubChem CID 175409528) has the molecular formula C24H20O5P+ and a molecular weight of 419.39 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;hydroxy-diphenoxy-phenylphosphanium.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;hydroxy-diphenoxy-phenylphosphanium |
|---|---|
| PubChem CID | 175409528 |
| Molecular Formula | C24H20O5P+ |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;hydroxy-diphenoxy-phenylphosphanium |
| SMILES | O=C1C=CC(=O)C=C1.O[P+](Oc1ccccc1)(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16O3P.C6H4O2/c19-22(18-14-8-3-9-15-18,20-16-10-4-1-5-11-16)21-17-12-6-2-7-13-17;7-5-1-2-6(8)4-3-5/h1-15,19H;1-4H/q+1; |
| InChIKey | PZTDWDZMWDDLLJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|