About benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium
benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium (PubChem CID 174804192) has the molecular formula C30H29O8P2+
and a molecular weight of 579.50 g/mol. Its IUPAC name is benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium.
Molecular Properties
| Compound Name | benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium |
| PubChem CID | 174804192 |
| Molecular Formula | C30H29O8P2+ |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium |
| SMILES | OP(O)O.Oc1cccc(O)c1.c1ccc(O[P+](Oc2ccccc2)(Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20O3P.C6H6O2.H3O3P/c1-5-13-21(14-6-1)25-28(24-19-11-4-12-20-24,26-22-15-7-2-8-16-22)27-23-17-9-3-10-18-23;7-5-2-1-3-6(8)4-5;1-4(2)3/h1-20H;1-4,7-8H;1-3H/q+1;; |
| InChIKey | JBHOZXUXYQYKHT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium?
The IUPAC name of benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium (CID 174804192) is benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium.
What is the SMILES notation for benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium?
The canonical SMILES for benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium is OP(O)O.Oc1cccc(O)c1.c1ccc(O[P+](Oc2ccccc2)(Oc2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium?
The InChIKey is JBHOZXUXYQYKHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O3P.C6H6O2.H3O3P/c1-5-13-21(14-6-1)25-28(24-19-11-4-12-20-24,26-22-15-7-2-8-16-22)27-23-17-9-3-10-18-23;7-5-2-1-3-6(8)4-5;1-4(2)3/h1-20H;1-4,7-8H;1-3H/q+1;;.
What are the key properties of benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium?
benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium has a molecular weight of 579.50 g/mol, XLogP of 6.60, 7 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;phosphorous acid;triphenoxy(phenyl)phosphanium is sourced from PubChem (CID 174804192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).