C17H24O9 — CID 175437102
5-methyl-2-methylidene-3-oxohexanoic acid;tris(prop-2-enoic acid) (PubChem CID 175437102) has the molecular formula C17H24O9 and a molecular weight of 372.37 g/mol. Its IUPAC name is 5-methyl-2-methylidene-3-oxohexanoic acid;tris(prop-2-enoic acid).
| Compound Name | 5-methyl-2-methylidene-3-oxohexanoic acid;tris(prop-2-enoic acid) |
|---|---|
| PubChem CID | 175437102 |
| Molecular Formula | C17H24O9 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-methyl-2-methylidene-3-oxohexanoic acid;tris(prop-2-enoic acid) |
| SMILES | C=C(C(=O)O)C(=O)CC(C)C.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O |
| InChI | InChI=1S/C8H12O3.3C3H4O2/c1-5(2)4-7(9)6(3)8(10)11;3*1-2-3(4)5/h5H,3-4H2,1-2H3,(H,10,11);3*2H,1H2,(H,4,5) |
| InChIKey | QCLWJNSPNMSPKW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|