C12H11BrN2S — CID 175443629
3-[3-(2-bromoethyl)-2H-1,3-thiazol-4-yl]benzonitrile (PubChem CID 175443629) has the molecular formula C12H11BrN2S and a molecular weight of 295.21 g/mol. Its IUPAC name is 3-[3-(2-bromoethyl)-2H-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 3-[3-(2-bromoethyl)-2H-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 175443629 |
| Molecular Formula | C12H11BrN2S |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 3-[3-(2-bromoethyl)-2H-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2=CSCN2CCBr)c1 |
| InChI | InChI=1S/C12H11BrN2S/c13-4-5-15-9-16-8-12(15)11-3-1-2-10(6-11)7-14/h1-3,6,8H,4-5,9H2 |
| InChIKey | HFRCNCWOLYXUSE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|