C29H33F6N5O8 — CID 175456152
tert-butyl N-[2-methyl-2-[(4R)-1,2,5-trifluoro-4-[5-[3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridin-2-yl]-1,3,4-oxadiazol-2-yl]-4-phenylmethoxypentoxy]propyl]carbamate (PubChem CID 175456152) has the molecular formula C29H33F6N5O8 and a molecular weight of 693.60 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-2-[(4R)-1,2,5-trifluoro-4-[5-[3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridin-2-yl]-1,3,4-oxadiazol-2-yl]-4-phenylmethoxypentoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-2-[(4R)-1,2,5-trifluoro-4-[5-[3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridin-2-yl]-1,3,4-oxadiazol-2-yl]-4-phenylmethoxypentoxy]propyl]carbamate |
|---|---|
| PubChem CID | 175456152 |
| Molecular Formula | C29H33F6N5O8 |
| Molecular Weight | 693.60 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | tert-butyl N-[2-methyl-2-[(4R)-1,2,5-trifluoro-4-[5-[3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridin-2-yl]-1,3,4-oxadiazol-2-yl]-4-phenylmethoxypentoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)OC(F)C(F)C[C@@](CF)(OCc1ccccc1)c1nnc(-c2[nH]c(=O)c(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C29H33F6N5O8/c1-26(2,3)48-25(42)36-15-27(4,5)47-21(32)18(31)12-28(14-30,45-13-16-9-7-6-8-10-16)24-39-38-23(46-24)20-19(40(43)44)11-17(22(41)37-20)29(33,34)35/h6-11,18,21H,12-15H2,1-5H3,(H,36,42)(H,37,41)/t18?,21?,28-/m0/s1 |
| InChIKey | MFIPYNPKBFLIQH-RYSAYUGBSA-N |
| XLogP | 6.08 |
| TPSA | 171.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|