C23H26BrN3O4 — CID 175467005
2-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-N-(4-oxooxolan-3-yl)cyclohexane-1-carboxamide (PubChem CID 175467005) has the molecular formula C23H26BrN3O4 and a molecular weight of 488.38 g/mol. Its IUPAC name is 2-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-N-(4-oxooxolan-3-yl)cyclohexane-1-carboxamide.
| Compound Name | 2-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-N-(4-oxooxolan-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175467005 |
| Molecular Formula | C23H26BrN3O4 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-(8-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-N-(4-oxooxolan-3-yl)cyclohexane-1-carboxamide |
| SMILES | O=C1COCC1NC(=O)C1CCCCC1C(=O)N1CCc2[nH]c3ccc(Br)cc3c2C1 |
| InChI | InChI=1S/C23H26BrN3O4/c24-13-5-6-18-16(9-13)17-10-27(8-7-19(17)25-18)23(30)15-4-2-1-3-14(15)22(29)26-20-11-31-12-21(20)28/h5-6,9,14-15,20,25H,1-4,7-8,10-12H2,(H,26,29) |
| InChIKey | KRBYVADGFIMQOB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|