C12H7N2O4S- — CID 175500465
1,3-dioxo-2-(sulfinatoamino)benzo[de]isoquinoline (PubChem CID 175500465) has the molecular formula C12H7N2O4S- and a molecular weight of 275.26 g/mol. Its IUPAC name is 1,3-dioxo-2-(sulfinatoamino)benzo[de]isoquinoline.
| Compound Name | 1,3-dioxo-2-(sulfinatoamino)benzo[de]isoquinoline |
|---|---|
| PubChem CID | 175500465 |
| Molecular Formula | C12H7N2O4S- |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1,3-dioxo-2-(sulfinatoamino)benzo[de]isoquinoline |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1NS(=O)[O-] |
| InChI | InChI=1S/C12H8N2O4S/c15-11-8-5-1-3-7-4-2-6-9(10(7)8)12(16)14(11)13-19(17)18/h1-6,13H,(H,17,18)/p-1 |
| InChIKey | MPVFUARLPJYIIF-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|