C12H15N3OS2 — CID 175500580
5-(1-phenoxypropylsulfanylmethyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 175500580) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 5-(1-phenoxypropylsulfanylmethyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(1-phenoxypropylsulfanylmethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 175500580 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-(1-phenoxypropylsulfanylmethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCC(Oc1ccccc1)SCc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C12H15N3OS2/c1-2-11(16-9-6-4-3-5-7-9)18-8-10-13-12(17)15-14-10/h3-7,11H,2,8H2,1H3,(H2,13,14,15,17) |
| InChIKey | RRLNCNHQFIKOFF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|