C31H42O5 — CID 175504080
4-ethenylphenol;1-ethenyl-4-(1-propan-2-yloxyethoxy)benzene;(1-ethylcyclopentyl) prop-2-enoate (PubChem CID 175504080) has the molecular formula C31H42O5 and a molecular weight of 494.67 g/mol. Its IUPAC name is 4-ethenylphenol;1-ethenyl-4-(1-propan-2-yloxyethoxy)benzene;(1-ethylcyclopentyl) prop-2-enoate.
| Compound Name | 4-ethenylphenol;1-ethenyl-4-(1-propan-2-yloxyethoxy)benzene;(1-ethylcyclopentyl) prop-2-enoate |
|---|---|
| PubChem CID | 175504080 |
| Molecular Formula | C31H42O5 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 4-ethenylphenol;1-ethenyl-4-(1-propan-2-yloxyethoxy)benzene;(1-ethylcyclopentyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CC)CCCC1.C=Cc1ccc(O)cc1.C=Cc1ccc(OC(C)OC(C)C)cc1 |
| InChI | InChI=1S/C13H18O2.C10H16O2.C8H8O/c1-5-12-6-8-13(9-7-12)15-11(4)14-10(2)3;1-3-9(11)12-10(4-2)7-5-6-8-10;1-2-7-3-5-8(9)6-4-7/h5-11H,1H2,2-4H3;3H,1,4-8H2,2H3;2-6,9H,1H2 |
| InChIKey | WWNPUZWCTUXIBU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|