C20H25ClN4O4 — CID 175520973
5-amino-6-chloro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylic acid (PubChem CID 175520973) has the molecular formula C20H25ClN4O4 and a molecular weight of 420.90 g/mol. Its IUPAC name is 5-amino-6-chloro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-6-chloro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175520973 |
| Molecular Formula | C20H25ClN4O4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-amino-6-chloro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylic acid |
| SMILES | C[C@@H](CCCCNC(=O)OCc1ccccc1)Nc1c(C(=O)O)cnc(Cl)c1N |
| InChI | InChI=1S/C20H25ClN4O4/c1-13(25-17-15(19(26)27)11-24-18(21)16(17)22)7-5-6-10-23-20(28)29-12-14-8-3-2-4-9-14/h2-4,8-9,11,13H,5-7,10,12,22H2,1H3,(H,23,28)(H,24,25)(H,26,27)/t13-/m0/s1 |
| InChIKey | WPLMSXVAJROYOU-ZDUSSCGKSA-N |
| XLogP | 3.91 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|