C22H27ClN4O6 — CID 166454364
ethyl 6-chloro-5-nitro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylate (PubChem CID 166454364) has the molecular formula C22H27ClN4O6 and a molecular weight of 478.93 g/mol. Its IUPAC name is ethyl 6-chloro-5-nitro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-5-nitro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 166454364 |
| Molecular Formula | C22H27ClN4O6 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 6-chloro-5-nitro-4-[[(2S)-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)c([N+](=O)[O-])c1N[C@@H](C)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27ClN4O6/c1-3-32-21(28)17-13-25-20(23)19(27(30)31)18(17)26-15(2)9-7-8-12-24-22(29)33-14-16-10-5-4-6-11-16/h4-6,10-11,13,15H,3,7-9,12,14H2,1-2H3,(H,24,29)(H,25,26)/t15-/m0/s1 |
| InChIKey | VQBOMHQMUQXFQG-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|